cas: 7292-74-2 — see every product listed under this CAS number, including other names
H-DL-Phg(3-F)-OH 98% (CAS 7292-74-2) is a chemical reagent available from Chemat. Available pack sizes: 100g, 500g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A459350-100g |
| cas | 7292-74-2 |
| size | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 8975.56 Pln | |
| Ambeed | 500g | 35686.69 Pln | |
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 270.25 Pln | |
| Ambeed | 5g | 887.69 Pln | |
| Ambeed | 25g | 2851.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A459350 |
2-amino-2-(3-fluorophenyl)acetic acid (CAS 7292-74-2) is a chemical compound with the molecular formula C8H8FNO2 and a molecular weight of 169.15 g/mol. IUPAC name: 2-amino-2-(3-fluorophenyl)acetic acid. InChIKey: LVYBCZIDQKJNFP-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO2 |
|---|---|
| Molecular weight | 169.15 g/mol |
| IUPAC name | 2-amino-2-(3-fluorophenyl)acetic acid |
| InChIKey | LVYBCZIDQKJNFP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(C(=O)O)N |
Computed by PubChem (NCBI)