cas: 156-86-5 — see every product listed under this CAS number, including other names
H-HoArg-OH 97% (CAS 156-86-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A129937-1g |
| cas | 156-86-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 10g | 253.56 Pln | |
| Ambeed | 25g | 442.69 Pln | |
| Ambeed | 100g | 1549.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A129937 |
L-homoarginine is an L-lysine derivative that is the L-enantiomer of homoarginine. It has a role as a biomarker, an EC 3.1.3.1 (alkaline phosphatase) inhibitor, a xenobiotic metabolite, a human metabolite and a rat metabolite. It is a homoarginine, a L-lysine derivative and a non-proteinogenic L-alpha-amino acid. It is a conjugate base of a L-homoarginine(1+).
Source: ChEBI
| Molecular formula | C7H16N4O2 |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | (2S)-2-amino-6-(diaminomethylideneamino)hexanoic acid |
| InChIKey | QUOGESRFPZDMMT-YFKPBYRVSA-N |
| SMILES | C(CCN=C(N)N)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)