CAS 367453-05-2 appears in our catalog under these names: H–Hyp(tBu)–OtBu·HCl, (4R)-4-(1,1-dimethylethoxy)-L-proline 1,1-dimethylethyl ester hydrochloride, 95%, 95%, H-Hyp(tBu)-OtBu.HCl, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 250mg, 1g, 100g.
Tert-butyl (2S,4R)-4-[(2-methylpropan-2-yl)oxy]pyrrolidine-2-carboxylate;hydrochloride (CAS 367453-05-2) is a chemical compound with the molecular formula C13H26ClNO3 and a molecular weight of 279.80 g/mol. IUPAC name: tert-butyl (2S,4R)-4-[(2-methylpropan-2-yl)oxy]pyrrolidine-2-carboxylate;hydrochloride. InChIKey: SSNWMVRXDJPQAN-UXQCFNEQSA-N.
| Molecular formula | C13H26ClNO3 |
|---|---|
| Molecular weight | 279.80 g/mol |
| IUPAC name | tert-butyl (2S,4R)-4-[(2-methylpropan-2-yl)oxy]pyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | SSNWMVRXDJPQAN-UXQCFNEQSA-N |
| SMILES | CC(C)(C)O[C@@H]1C[C@H](NC1)C(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)