CAS 16689-14-8 appears in our catalog under these names: H-Leu-Leu-OMeHBr, H-Leu-Leu-OMe HBr, H–Leu–Leu–OMe · HBr, H-Leu-Leu-OMe·HBr, (S)-Methyl 2-((S)-2-amino-4-methylpentanamido)-4-methylpentanoate hydrobromide, 97%, 97%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 2,5g, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1g.
Methyl (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-4-methylpentanoate;hydrobromide (CAS 16689-14-8) is a chemical compound with the molecular formula C13H27BrN2O3 and a molecular weight of 339.27 g/mol. IUPAC name: methyl (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-4-methylpentanoate;hydrobromide. InChIKey: QIPBCIHWFATZOF-ACMTZBLWSA-N.
| Molecular formula | C13H27BrN2O3 |
|---|---|
| Molecular weight | 339.27 g/mol |
| IUPAC name | methyl (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-4-methylpentanoate;hydrobromide |
| InChIKey | QIPBCIHWFATZOF-ACMTZBLWSA-N |
| SMILES | CC(C)C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)OC)N.Br |
Computed by PubChem (NCBI)