CAS 6485-52-5 appears in our catalog under these names: L-Phenylglycine Amide, >95% (HPLC), L-Phenylglycine Amide, (S)–2–Amino–2–phenylacetamide, (S)-(+)-2-Phenylglycine amide, L-Phenylglycinamide, 97%, 97%. Offered by: TRC, Mikromol, GLPBio, Biosynth, Chemat. Available pack sizes: 250g, 25g, 50g, 100mg, 100g, 500g, 1g, 5g.
(2S)-2-amino-2-phenylacetamide (CAS 6485-52-5) is a chemical compound with the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. IUPAC name: (2S)-2-amino-2-phenylacetamide. InChIKey: KIYRSYYOVDHSPG-ZETCQYMHSA-N.
| Molecular formula | C8H10N2O |
|---|---|
| Molecular weight | 150.18 g/mol |
| IUPAC name | (2S)-2-amino-2-phenylacetamide |
| InChIKey | KIYRSYYOVDHSPG-ZETCQYMHSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](C(=O)N)N |
Computed by PubChem (NCBI)