cas: 16652-76-9 — see every product listed under this CAS number, including other names
H-Val-OBzl.Tos-OH, >95.0%(HPLC)(T) (CAS 16652-76-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | V0207-5G |
| cas | 16652-76-9 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 206.86 Pln | |
| TCI | 25g | 442.88 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(HPLC)(T) |
Benzyl (2S)-2-amino-3-methylbutanoate;4-methylbenzenesulfonic acid (CAS 16652-76-9) is a chemical compound with the molecular formula C19H25NO5S and a molecular weight of 379.5 g/mol. IUPAC name: benzyl (2S)-2-amino-3-methylbutanoate;4-methylbenzenesulfonic acid. InChIKey: QWUQVUDPBXFOKF-MERQFXBCSA-N.
| Molecular formula | C19H25NO5S |
|---|---|
| Molecular weight | 379.5 g/mol |
| IUPAC name | benzyl (2S)-2-amino-3-methylbutanoate;4-methylbenzenesulfonic acid |
| InChIKey | QWUQVUDPBXFOKF-MERQFXBCSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CC(C)[C@@H](C(=O)OCC1=CC=CC=C1)N |
Computed by PubChem (NCBI)