cas: 1229652-21-4 — see every product listed under this CAS number, including other names
HA130 99% (CAS 1229652-21-4) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A662242-5mg |
| cas | 1229652-21-4 |
| size | 5mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5mg | 303.62 Pln | |
| Ambeed | 10mg | 464.94 Pln | |
| Ambeed | 25mg | 843.19 Pln | |
| Ambeed | 50mg | 1338.25 Pln | |
| Ambeed | 100mg | 2306.13 Pln | |
| Ambeed | 250mg | 4419.88 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A662242 |
[3-[[4-[(Z)-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]phenyl]boronic acid (CAS 1229652-21-4) is a chemical compound with the molecular formula C24H19BFNO5S and a molecular weight of 463.3 g/mol. IUPAC name: [3-[[4-[(Z)-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]phenyl]boronic acid. InChIKey: VTNKMYWFWQTEHE-XKZIYDEJSA-N.
| Molecular formula | C24H19BFNO5S |
|---|---|
| Molecular weight | 463.3 g/mol |
| IUPAC name | [3-[[4-[(Z)-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]phenyl]boronic acid |
| InChIKey | VTNKMYWFWQTEHE-XKZIYDEJSA-N |
| SMILES | B(C1=CC(=CC=C1)COC2=CC=C(C=C2)/C=C\3/C(=O)N(C(=O)S3)CC4=CC=C(C=C4)F)(O)O |
Computed by PubChem (NCBI)