cas: 105598-27-4 — see every product listed under this CAS number, including other names
HAT-CN 95% (CAS 105598-27-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 500g, 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A422951-10g |
| cas | 105598-27-4 |
| size | 10g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 1321.56 Pln | |
| Ambeed | 500g | 33695.31 Pln | |
| Ambeed | 100mg | 170.12 Pln | |
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 698.56 Pln | |
| Ambeed | 25g | 2178.19 Pln | |
| Ambeed | 100g | 8474.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A422951 |
3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene-4,5,10,11,16,17-hexacarbonitrile (CAS 105598-27-4) is a chemical compound with the molecular formula C18N12 and a molecular weight of 384.3 g/mol. IUPAC name: 3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene-4,5,10,11,16,17-hexacarbonitrile. InChIKey: DKHNGUNXLDCATP-UHFFFAOYSA-N.
| Molecular formula | C18N12 |
|---|---|
| Molecular weight | 384.3 g/mol |
| IUPAC name | 3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene-4,5,10,11,16,17-hexacarbonitrile |
| InChIKey | DKHNGUNXLDCATP-UHFFFAOYSA-N |
| SMILES | C(#N)C1=C(N=C2C(=N1)C3=NC(=C(N=C3C4=NC(=C(N=C24)C#N)C#N)C#N)C#N)C#N |
Computed by PubChem (NCBI)