CAS 848133-17-5 appears in our catalog under these names: HKI 357, HKI-357/ 98.31% (existing batch purity), HKI 357, HKI 357, 98%, 98%, HKI-357, 99.24%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 25 mg, 1 mg.
(E)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide (CAS 848133-17-5) is a chemical compound with the molecular formula C31H29ClFN5O3 and a molecular weight of 574.0 g/mol. IUPAC name: (E)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide. InChIKey: NERXPXBELDBEPZ-RMKNXTFCSA-N.
| Molecular formula | C31H29ClFN5O3 |
|---|---|
| Molecular weight | 574.0 g/mol |
| IUPAC name | (E)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide |
| InChIKey | NERXPXBELDBEPZ-RMKNXTFCSA-N |
| SMILES | CCOC1=C(C=C2C(=C1)N=CC(=C2NC3=CC(=C(C=C3)OCC4=CC(=CC=C4)F)Cl)C#N)NC(=O)/C=C/CN(C)C |
Computed by PubChem (NCBI)