cas: 2243942-52-9 — see every product listed under this CAS number, including other names
HO-PEG24-OH, 97%, 97% (CAS 2243942-52-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50g, 100g, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FPXK-25g |
| cas | 2243942-52-9 |
| size | 25g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 5219.60 Pln | |
| Chemat | 50g | 9650.00 Pln | |
| Chemat | 100g | 16298.00 Pln | |
| Chemat | 50mg | 318.80 Pln | |
| Chemat | 100mg | 366.80 Pln | |
| Chemat | 250mg | 794.00 Pln | |
| Chemat | 1g | 1350.80 Pln | |
| Chemat | 5g | 4446.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol (CAS 2243942-52-9) is a chemical compound with the molecular formula C48H98O25 and a molecular weight of 1075.3 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol. InChIKey: IEXKUCOGQITOPO-UHFFFAOYSA-N.
| Molecular formula | C48H98O25 |
|---|---|
| Molecular weight | 1075.3 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| InChIKey | IEXKUCOGQITOPO-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO)O |
Computed by PubChem (NCBI)