HPGDS inhibitor 1, 98%
cas: 1033836-12-2 — see every product listed under this CAS number, including other names
HPGDS inhibitor 1, 98% (CAS 1033836-12-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1mg, 5mg, 10mg, 25mg, 50mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A414719-100mg |
| cas | 1033836-12-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1460.62 Pln | |
| Ambeed | 250mg | 2573.12 Pln | |
| Chemat | 1mg | 131.60 Pln | |
| Chemat | 5mg | 242.00 Pln | |
| Chemat | 10mg | 280.40 Pln | |
| Chemat | 25mg | 410.00 Pln | |
| Chemat | 50mg | 654.80 Pln | |
| Chemat | 100mg | 1072.40 Pln | |
| Chemat | 250mg | 1878.80 Pln | |
| BLDpharm | 25mg | 597.59 Pln | |
| BLDpharm | 50mg | 953.02 Pln | |
| BLDpharm | 100mg | 1569.47 Pln | |
| BLDpharm | 250mg | 2769.05 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
6-(3-fluorophenyl)-N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]pyridine-3-carboxamide (CAS 1033836-12-2) is a chemical compound with the molecular formula C19H19F4N3O and a molecular weight of 381.4 g/mol. IUPAC name: 6-(3-fluorophenyl)-N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]pyridine-3-carboxamide. InChIKey: LPUCBGGXXIUBAZ-UHFFFAOYSA-N.
| Molecular formula | C19H19F4N3O |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | 6-(3-fluorophenyl)-N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]pyridine-3-carboxamide |
| InChIKey | LPUCBGGXXIUBAZ-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1NC(=O)C2=CN=C(C=C2)C3=CC(=CC=C3)F)CC(F)(F)F |
Computed by PubChem (NCBI)
