cas: 2158197-70-5 — see every product listed under this CAS number, including other names
HS-1371 97% (CAS 2158197-70-5) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A982329-1mg |
| cas | 2158197-70-5 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 203.50 Pln | |
| Ambeed | 5mg | 337.00 Pln | |
| Ambeed | 10mg | 464.94 Pln | |
| Ambeed | 50mg | 1327.12 Pln | |
| Ambeed | 100mg | 2206.00 Pln | |
| Ambeed | 250mg | 3691.19 Pln | |
| Ambeed | 1g | 9843.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A982329 |
4-(4-methylphenoxy)-7-(1-piperidin-4-ylpyrazol-4-yl)quinoline (CAS 2158197-70-5) is a chemical compound with the molecular formula C24H24N4O and a molecular weight of 384.5 g/mol. IUPAC name: 4-(4-methylphenoxy)-7-(1-piperidin-4-ylpyrazol-4-yl)quinoline. InChIKey: VPVLPCIBKVWFDT-UHFFFAOYSA-N.
| Molecular formula | C24H24N4O |
|---|---|
| Molecular weight | 384.5 g/mol |
| IUPAC name | 4-(4-methylphenoxy)-7-(1-piperidin-4-ylpyrazol-4-yl)quinoline |
| InChIKey | VPVLPCIBKVWFDT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OC2=C3C=CC(=CC3=NC=C2)C4=CN(N=C4)C5CCNCC5 |
Computed by PubChem (NCBI)