cas: 115457-83-5 — see every product listed under this CAS number, including other names
Hecameg, 98%, 98% (CAS 115457-83-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111G19-100mg |
| cas | 115457-83-5 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 309.20 Pln | |
| Chemat | 1g | 597.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl N-heptylcarbamate (CAS 115457-83-5) is a chemical compound with the molecular formula C15H29NO7 and a molecular weight of 335.39 g/mol. IUPAC name: [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl N-heptylcarbamate. InChIKey: XPIVOYOQXKNYHA-RGDJUOJXSA-N.
| Molecular formula | C15H29NO7 |
|---|---|
| Molecular weight | 335.39 g/mol |
| IUPAC name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl N-heptylcarbamate |
| InChIKey | XPIVOYOQXKNYHA-RGDJUOJXSA-N |
| SMILES | CCCCCCCNC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)OC)O)O)O |
Computed by PubChem (NCBI)