CAS 994-49-0 appears in our catalog under these names: 1,1,1,3,3,3–Hexaethyldisiloxane, Hexaethyldisiloxane, 99% , Hexaethyldisiloxane, >98.0%(GC), 1,1,1,3,3,3-Hexaethyldisiloxane 97%, 1,1,1,3,3,3-Hexaethyldisiloxane, 98%, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 100g, 25g, 500g, 5g, 1g, 10g, 50g, 250g.
Triethyl(triethylsilyloxy)silane (CAS 994-49-0) is a chemical compound with the molecular formula C12H30OSi2 and a molecular weight of 246.54 g/mol. IUPAC name: triethyl(triethylsilyloxy)silane. InChIKey: WILBTFWIBAOWLN-UHFFFAOYSA-N.
| Molecular formula | C12H30OSi2 |
|---|---|
| Molecular weight | 246.54 g/mol |
| IUPAC name | triethyl(triethylsilyloxy)silane |
| InChIKey | WILBTFWIBAOWLN-UHFFFAOYSA-N |
| SMILES | CC[Si](CC)(CC)O[Si](CC)(CC)CC |
Computed by PubChem (NCBI)