CAS 376-68-1 appears in our catalog under these names: Hexafluoroglutaric anhydride, 95%, 2,2,3,3,4,4-Hexafluoropentanedioic Anhydride, >97.0%(T). Offered by: Combi-blocks, TCI. Available pack sizes: 1g, 100g, 25g, 5g.
3,3,4,4,5,5-hexafluorooxane-2,6-dione (CAS 376-68-1) is a chemical compound with the molecular formula C5F6O3 and a molecular weight of 222.04 g/mol. IUPAC name: 3,3,4,4,5,5-hexafluorooxane-2,6-dione. InChIKey: IHYAGCYJVNHXCT-UHFFFAOYSA-N.
| Molecular formula | C5F6O3 |
|---|---|
| Molecular weight | 222.04 g/mol |
| IUPAC name | 3,3,4,4,5,5-hexafluorooxane-2,6-dione |
| InChIKey | IHYAGCYJVNHXCT-UHFFFAOYSA-N |
| SMILES | C1(=O)C(C(C(C(=O)O1)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)