Hydrogen tetrakis[3,5-bis(trifluoromethyl)phenyl]borate compound with methyl L-alaninate, 95%
cas: 2407632-32-8 — see every product listed under this CAS number, including other names
Hydrogen tetrakis[3,5-bis(trifluoromethyl)phenyl]borate compound with methyl L-alaninate, 95% (CAS 2407632-32-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 25mg, 50mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1961629-100mg |
| cas | 2407632-32-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1182.50 Pln | |
| Ambeed | 250mg | 1955.69 Pln | |
| BLDpharm | 25mg | 480.97 Pln | |
| BLDpharm | 50mg | 775.31 Pln | |
| BLDpharm | 100mg | 1269.58 Pln | |
| BLDpharm | 250mg | 2102.62 Pln | |
| Chemat | 25mg | 486.80 Pln | |
| Chemat | 50mg | 784.40 Pln | |
| Chemat | 100mg | 1288.40 Pln | |
| Chemat | 250mg | 2147.60 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Hydron;methyl (2S)-2-aminopropanoate;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide (CAS 2407632-32-8) is a chemical compound with the molecular formula C36H22BF24NO2 and a molecular weight of 967.3 g/mol. IUPAC name: hydron;methyl (2S)-2-aminopropanoate;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide. InChIKey: DOXFUNZRTNZHEB-HVDRVSQOSA-O.
| Molecular formula | C36H22BF24NO2 |
|---|---|
| Molecular weight | 967.3 g/mol |
| IUPAC name | hydron;methyl (2S)-2-aminopropanoate;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide |
| InChIKey | DOXFUNZRTNZHEB-HVDRVSQOSA-O |
| SMILES | [H+].[B-](C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)(C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F)(C3=CC(=CC(=C3)C(F)(F)F)C(F)(F)F)C4=CC(=CC(=C4)C(F)(F)F)C(F)(F)F.C[C@@H](C(=O)OC)N |
Computed by PubChem (NCBI)