cas: 3168-01-2 — see every product listed under this CAS number, including other names
Hydroxyhexamide (CAS 3168-01-2) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 1mg. Offered by: GLPBio, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC60920-10 |
| cas | 3168-01-2 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 1425.49 Pln | |
| GLPBio | 25mg | 2235.21 Pln | |
| GLPBio | 5mg | 1046.37 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 1111.89 Pln | |
| Chemat | 5mg | 674.00 Pln | |
| Chemat | 25mg | 2046.80 Pln | |
| Chemat | 1mg | 328.40 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
Hydroxyhexamide is a sulfonamide.
Source: ChEBI
| Molecular formula | C15H22N2O4S |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 1-cyclohexyl-3-[4-(1-hydroxyethyl)phenyl]sulfonylurea |
| InChIKey | VQDAEOYLIBGCHE-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)S(=O)(=O)NC(=O)NC2CCCCC2)O |
Computed by PubChem (NCBI)