Hyoscyamine sulfate (2:1)
cas: 620-61-1 — see every product listed under this CAS number, including other names
Hyoscyamine sulfate (2:1) (CAS 620-61-1) is a chemical reagent available from Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114QZ0-2mg |
| cas | 620-61-1 |
| size | 2mg |
| availability | 0.2g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 2mg | 126.80 Pln | |
| Chemat | 5mg | 155.60 Pln | |
| Chemat | 10mg | 189.20 Pln | |
| Chemat | 25mg | 256.40 Pln | |
| Chemat | 50mg | 352.40 Pln | |
| Chemat | 100mg | 486.80 Pln | |
| Chemat | 200mg | 683.60 Pln |
properties
| delivery time | 3 weeks |
|---|
Bis([(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (2S)-3-hydroxy-2-phenylpropanoate);sulfuric acid (CAS 620-61-1) is a chemical compound with the molecular formula C34H48N2O10S and a molecular weight of 676.8 g/mol. IUPAC name: bis([(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (2S)-3-hydroxy-2-phenylpropanoate);sulfuric acid. InChIKey: HOBWAPHTEJGALG-LFQBMQRVSA-N.
| Molecular formula | C34H48N2O10S |
|---|---|
| Molecular weight | 676.8 g/mol |
| IUPAC name | bis([(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (2S)-3-hydroxy-2-phenylpropanoate);sulfuric acid |
| InChIKey | HOBWAPHTEJGALG-LFQBMQRVSA-N |
| SMILES | CN1[C@@H]2CC[C@H]1CC(C2)OC(=O)[C@H](CO)C3=CC=CC=C3.CN1[C@@H]2CC[C@H]1CC(C2)OC(=O)[C@H](CO)C3=CC=CC=C3.OS(=O)(=O)O |
Computed by PubChem (NCBI)