cas: 159752-10-0 — see every product listed under this CAS number, including other names
Ibutamoren Mesylate 98% (CAS 159752-10-0) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A370432-1mg |
| cas | 159752-10-0 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 175.69 Pln | |
| Ambeed | 5mg | 197.94 Pln | |
| Ambeed | 10mg | 220.19 Pln | |
| Ambeed | 25mg | 253.56 Pln | |
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 1354.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A370432 |
2-amino-2-methyl-N-[(2R)-1-(1-methylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)-1-oxo-3-phenylmethoxypropan-2-yl]propanamide;methanesulfonic acid (CAS 159752-10-0) is a chemical compound with the molecular formula C28H40N4O8S2 and a molecular weight of 624.8 g/mol. IUPAC name: 2-amino-2-methyl-N-[(2R)-1-(1-methylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)-1-oxo-3-phenylmethoxypropan-2-yl]propanamide;methanesulfonic acid. InChIKey: DUGMCDWNXXFHDE-VZYDHVRKSA-N.
| Molecular formula | C28H40N4O8S2 |
|---|---|
| Molecular weight | 624.8 g/mol |
| IUPAC name | 2-amino-2-methyl-N-[(2R)-1-(1-methylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)-1-oxo-3-phenylmethoxypropan-2-yl]propanamide;methanesulfonic acid |
| InChIKey | DUGMCDWNXXFHDE-VZYDHVRKSA-N |
| SMILES | CC(C)(C(=O)N[C@H](COCC1=CC=CC=C1)C(=O)N2CCC3(CC2)CN(C4=CC=CC=C34)S(=O)(=O)C)N.CS(=O)(=O)O |
Computed by PubChem (NCBI)