cas: 138937-28-7 — see every product listed under this CAS number, including other names
Indoline-5,6-diol Hydrobromide, 98%, 98% (CAS 138937-28-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110BD1-100mg |
| cas | 138937-28-7 |
| size | 100mg |
| availability | 485.33g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 280.40 Pln | |
| Chemat | 25g | 890.00 Pln | |
| Chemat | 50g | 1509.20 Pln | |
| Chemat | 100g | 2334.80 Pln | |
| Chemat | 250g | 4197.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,3-dihydro-1H-indole-5,6-diol;hydrobromide (CAS 138937-28-7) is a chemical compound with the molecular formula C8H10BrNO2 and a molecular weight of 232.07 g/mol. IUPAC name: 2,3-dihydro-1H-indole-5,6-diol;hydrobromide. InChIKey: TXMQOPNBBITFNX-UHFFFAOYSA-N.
| Molecular formula | C8H10BrNO2 |
|---|---|
| Molecular weight | 232.07 g/mol |
| IUPAC name | 2,3-dihydro-1H-indole-5,6-diol;hydrobromide |
| InChIKey | TXMQOPNBBITFNX-UHFFFAOYSA-N |
| SMILES | C1CNC2=CC(=C(C=C21)O)O.Br |
Computed by PubChem (NCBI)