cas: 160003-66-7 — see every product listed under this CAS number, including other names
Iniparib 98% (CAS 160003-66-7) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A352626-1mg |
| cas | 160003-66-7 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 120.06 Pln | |
| Ambeed | 5mg | 131.19 Pln | |
| Ambeed | 10mg | 147.88 Pln | |
| Ambeed | 25mg | 164.56 Pln | |
| Ambeed | 50mg | 186.81 Pln | |
| Ambeed | 100mg | 209.06 Pln | |
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 403.75 Pln | |
| Ambeed | 25g | 1232.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A352626 |
4-iodo-3-nitrobenzamide is an organohalogen compound and a carbonyl compound.
Source: ChEBI
| Molecular formula | C7H5IN2O3 |
|---|---|
| Molecular weight | 292.03 g/mol |
| IUPAC name | 4-iodo-3-nitrobenzamide |
| InChIKey | MDOJTZQKHMAPBK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)N)[N+](=O)[O-])I |
Computed by PubChem (NCBI)