Products 14017-39-1
CAS 14017-39-1 appears in our catalog under these names: Iron(II) sulfamate, 1 kg, Iron(II)sulfamate, Iron(II) sulfamate, Iron(II) sulfamate, 38-42% aqueous solution, 38-42% aqueous solution, Iron(II) sulfamate, 100 g. Offered by: Roth, GLPBio, Biosynth, Chemat, Ambeed. Available pack sizes: 1kg, 250g, 100g, 500g, 1000g, 1g, 5g.
Iron(2+) disulfamate (CAS 14017-39-1) is a chemical compound with the molecular formula FeH4N2O6S2 and a molecular weight of 248.02 g/mol. IUPAC name: iron(2+) disulfamate. InChIKey: SQZYOZWYVFYNFV-UHFFFAOYSA-L.
| Molecular formula | FeH4N2O6S2 |
|---|---|
| Molecular weight | 248.02 g/mol |
| IUPAC name | iron(2+) disulfamate |
| InChIKey | SQZYOZWYVFYNFV-UHFFFAOYSA-L |
| SMILES | NS(=O)(=O)[O-].NS(=O)(=O)[O-].[Fe+2] |
Computed by PubChem (NCBI)