cas: 13602-12-5 — see every product listed under this CAS number, including other names
Isonicotinic acid 1-oxide, 98% (CAS 13602-12-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 50g, 100g, 250g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F065973-5G |
| cas | 13602-12-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 25g | 164.54 Pln | |
| Fluorochem | 50g | 253.05 Pln | |
| Fluorochem | 100g | 383.22 Pln | |
| Fluorochem | 250g | 851.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Isonicotinic acid N-oxide is a member of pyridines and an aromatic carboxylic acid.
Source: ChEBI
| Molecular formula | C6H5NO3 |
|---|---|
| Molecular weight | 139.11 g/mol |
| IUPAC name | 1-oxidopyridin-1-ium-4-carboxylic acid |
| InChIKey | QCWTWMJMLSKQCJ-UHFFFAOYSA-N |
| SMILES | C1=C[N+](=CC=C1C(=O)O)[O-] |
Computed by PubChem (NCBI)