cas: 80278-67-7 — see every product listed under this CAS number, including other names
Isoquinoline-5-carbaldehyde, 98%, 98% (CAS 80278-67-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116BS6-250mg |
| cas | 80278-67-7 |
| size | 250mg |
| availability | 150g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 386.00 Pln | |
| Chemat | 25g | 1586.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Isoquinoline-5-carbaldehyde (CAS 80278-67-7) is a chemical compound with the molecular formula C10H7NO and a molecular weight of 157.17 g/mol. IUPAC name: isoquinoline-5-carbaldehyde. InChIKey: ILRSABOCKMOFGW-UHFFFAOYSA-N.
| Molecular formula | C10H7NO |
|---|---|
| Molecular weight | 157.17 g/mol |
| IUPAC name | isoquinoline-5-carbaldehyde |
| InChIKey | ILRSABOCKMOFGW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2)C(=C1)C=O |
Computed by PubChem (NCBI)