cas: 2445499-20-5 — see every product listed under this CAS number, including other names
JAK-IN-21 99% (CAS 2445499-20-5) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1682342-1mg |
| cas | 2445499-20-5 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 414.88 Pln | |
| Ambeed | 5mg | 587.31 Pln | |
| Ambeed | 10mg | 843.19 Pln | |
| Ambeed | 25mg | 1616.38 Pln | |
| Ambeed | 50mg | 2684.38 Pln | |
| Ambeed | 100mg | 4514.44 Pln | |
| Ambeed | 250mg | 7623.88 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1682342 |
N-(cyanomethyl)-4-[2-[[1-(cyanomethyl)pyrazol-4-yl]amino]-5-methylpyrimidin-4-yl]benzamide (CAS 2445499-20-5) is a chemical compound with the molecular formula C19H16N8O and a molecular weight of 372.4 g/mol. IUPAC name: N-(cyanomethyl)-4-[2-[[1-(cyanomethyl)pyrazol-4-yl]amino]-5-methylpyrimidin-4-yl]benzamide. InChIKey: HTJNRNRPDXBRQY-UHFFFAOYSA-N.
| Molecular formula | C19H16N8O |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | N-(cyanomethyl)-4-[2-[[1-(cyanomethyl)pyrazol-4-yl]amino]-5-methylpyrimidin-4-yl]benzamide |
| InChIKey | HTJNRNRPDXBRQY-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(N=C1C2=CC=C(C=C2)C(=O)NCC#N)NC3=CN(N=C3)CC#N |
Computed by PubChem (NCBI)