cas: 353512-04-6 — see every product listed under this CAS number, including other names
JAK2-IN-6 98% (CAS 353512-04-6) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1364451-1mg |
| cas | 353512-04-6 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 214.62 Pln | |
| Ambeed | 5mg | 275.81 Pln | |
| Ambeed | 10mg | 364.81 Pln | |
| Ambeed | 25mg | 431.56 Pln | |
| Ambeed | 50mg | 509.44 Pln | |
| Ambeed | 100mg | 809.81 Pln | |
| Ambeed | 250mg | 1466.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1364451 |
(4-amino-2-anilino-1,3-thiazol-5-yl)-(5-chlorothiophen-2-yl)methanone (CAS 353512-04-6) is a chemical compound with the molecular formula C14H10ClN3OS2 and a molecular weight of 335.8 g/mol. IUPAC name: (4-amino-2-anilino-1,3-thiazol-5-yl)-(5-chlorothiophen-2-yl)methanone. InChIKey: OFSYMZBCAABWIK-UHFFFAOYSA-N.
| Molecular formula | C14H10ClN3OS2 |
|---|---|
| Molecular weight | 335.8 g/mol |
| IUPAC name | (4-amino-2-anilino-1,3-thiazol-5-yl)-(5-chlorothiophen-2-yl)methanone |
| InChIKey | OFSYMZBCAABWIK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC(=C(S2)C(=O)C3=CC=C(S3)Cl)N |
Computed by PubChem (NCBI)