cas: 604769-01-9 — see every product listed under this CAS number, including other names
JNJ-16241199 98+% (CAS 604769-01-9) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A580142-1mg |
| cas | 604769-01-9 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 776.44 Pln | |
| Ambeed | 5mg | 1282.62 Pln | |
| Ambeed | 10mg | 2050.25 Pln | |
| Ambeed | 25mg | 3513.19 Pln | |
| Ambeed | 50mg | 5226.44 Pln | |
| Ambeed | 100mg | 7818.56 Pln | |
| Ambeed | 250mg | 10711.06 Pln |
| purity | 98+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A580142 |
N-hydroxy-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)pyrimidine-5-carboxamide (CAS 604769-01-9) is a chemical compound with the molecular formula C19H19N5O4S and a molecular weight of 413.5 g/mol. IUPAC name: N-hydroxy-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)pyrimidine-5-carboxamide. InChIKey: MUTBJZVSRNUIHA-UHFFFAOYSA-N.
| Molecular formula | C19H19N5O4S |
|---|---|
| Molecular weight | 413.5 g/mol |
| IUPAC name | N-hydroxy-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)pyrimidine-5-carboxamide |
| InChIKey | MUTBJZVSRNUIHA-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=NC=C(C=N2)C(=O)NO)S(=O)(=O)C3=CC4=CC=CC=C4C=C3 |
Computed by PubChem (NCBI)