JohnPhos 97%
cas: 224311-51-7 — see every product listed under this CAS number, including other names
JohnPhos 97% (CAS 224311-51-7) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A472747-1000g |
| cas | 224311-51-7 |
| size | 1000g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 10038.00 Pln | |
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 192.38 Pln | |
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 414.88 Pln | |
| Ambeed | 100g | 1316.00 Pln | |
| Ambeed | 500g | 6300.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A472747 |
Ditert-butyl-(2-phenylphenyl)phosphane (CAS 224311-51-7) is a chemical compound with the molecular formula C20H27P and a molecular weight of 298.4 g/mol. IUPAC name: ditert-butyl-(2-phenylphenyl)phosphane. InChIKey: CNXMDTWQWLGCPE-UHFFFAOYSA-N.
| Molecular formula | C20H27P |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | ditert-butyl-(2-phenylphenyl)phosphane |
| InChIKey | CNXMDTWQWLGCPE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)P(C1=CC=CC=C1C2=CC=CC=C2)C(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
2-(Di-tert-butylphosphino)biphenyl, Johnphos phosphine ligand [MI], di(tert-butyl)(1,1'-biphenyl-2-yl)phosphine, (1,1'-Biphenyl)-2-ylbis(1,1-dimethylethyl)phosphine, Buchwald phosphine ligands, johnphos phosphine ligand-, Phosphine, (1,1'-biphenyl)-2-ylbis(1,1-dimethylethyl)-, JOHNPHOS PHOSPHINE LIGAND, JohnPhos, ditert-butyl-(2-phenylphenyl)phosphane, (2-Biphenyl)di-tert-butylphosphine