KT172
cas: 1402612-56-9 — see every product listed under this CAS number, including other names
KT172 (CAS 1402612-56-9) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 5mg, 50mg. Offered by: GLPBio, TargetMol.
| brand | GLPBio |
|---|---|
| catalog number | GC45491-10 |
| cas | 1402612-56-9 |
| size | 10mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 1556.54 Pln | |
| GLPBio | 25mg | 2951.33 Pln | |
| GLPBio | 5mg | 1046.37 Pln | |
| GLPBio | 50mg | 4219.75 Pln | |
| GLPBio | 10mg | 1556.54 Pln | |
| GLPBio | 25mg | 2951.33 Pln | |
| GLPBio | 5mg | 1046.37 Pln | |
| GLPBio | 50mg | 4219.75 Pln | |
| TargetMol | 5mg | 1727.19 Pln | |
| TargetMol | 10mg | 2962.58 Pln | |
| TargetMol | 25mg | 6269.62 Pln | |
| TargetMol | 50mg | 9284.87 Pln |
properties
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2-benzylpiperidin-1-yl)-[4-[4-(2-methoxyphenyl)phenyl]triazol-1-yl]methanone (CAS 1402612-56-9) is a chemical compound with the molecular formula C28H28N4O2 and a molecular weight of 452.5 g/mol. IUPAC name: (2-benzylpiperidin-1-yl)-[4-[4-(2-methoxyphenyl)phenyl]triazol-1-yl]methanone. InChIKey: MXVVJNJNDCJCFS-UHFFFAOYSA-N.
| Molecular formula | C28H28N4O2 |
|---|---|
| Molecular weight | 452.5 g/mol |
| IUPAC name | (2-benzylpiperidin-1-yl)-[4-[4-(2-methoxyphenyl)phenyl]triazol-1-yl]methanone |
| InChIKey | MXVVJNJNDCJCFS-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1C2=CC=C(C=C2)C3=CN(N=N3)C(=O)N4CCCCC4CC5=CC=CC=C5 |
Computed by PubChem (NCBI)