KT182
cas: 1402612-62-7 — see every product listed under this CAS number, including other names
KT182 (CAS 1402612-62-7) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 100mg, 200mg. Offered by: GLPBio, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC16756-1 |
| cas | 1402612-62-7 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1mg | 709.37 Pln | |
| GLPBio | 10mg | 1636.11 Pln | |
| GLPBio | 25mg | 2586.25 Pln | |
| GLPBio | 5mg | 1172.74 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 1247.63 Pln | |
| Chemat | 1mg | 338.00 Pln | |
| Chemat | 5mg | 731.60 Pln | |
| Chemat | 10mg | 1187.60 Pln | |
| Chemat | 25mg | 2099.60 Pln | |
| Chemat | 50mg | 2997.20 Pln | |
| Chemat | 100mg | 4029.20 Pln | |
| Chemat | 200mg | 5483.60 Pln |
properties
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
[4-[4-[3-(hydroxymethyl)phenyl]phenyl]triazol-1-yl]-(2-phenylpiperidin-1-yl)methanone (CAS 1402612-62-7) is a chemical compound with the molecular formula C27H26N4O2 and a molecular weight of 438.5 g/mol. IUPAC name: [4-[4-[3-(hydroxymethyl)phenyl]phenyl]triazol-1-yl]-(2-phenylpiperidin-1-yl)methanone. InChIKey: GICNKPZHUCVFNM-UHFFFAOYSA-N.
| Molecular formula | C27H26N4O2 |
|---|---|
| Molecular weight | 438.5 g/mol |
| IUPAC name | [4-[4-[3-(hydroxymethyl)phenyl]phenyl]triazol-1-yl]-(2-phenylpiperidin-1-yl)methanone |
| InChIKey | GICNKPZHUCVFNM-UHFFFAOYSA-N |
| SMILES | C1CCN(C(C1)C2=CC=CC=C2)C(=O)N3C=C(N=N3)C4=CC=C(C=C4)C5=CC=CC(=C5)CO |
Computed by PubChem (NCBI)
Synonyms:
orb1709312