cas: 968-21-8 — see every product listed under this CAS number, including other names
L-Leucyl-L-tyrosine, 98.0%, 98.0% (CAS 968-21-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114RCN-100mg |
| cas | 968-21-8 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 294.80 Pln | |
| Chemat | 1g | 746.00 Pln | |
| Chemat | 5g | 3347.60 Pln |
| purity | 98.0% |
|---|---|
| delivery time | 3 weeks |
Leu-Tyr is a dipeptide formed from L-leucine and L-tyrosine residues. It has a role as a metabolite. It is functionally related to a L-leucine and a L-tyrosine.
Source: ChEBI
| Molecular formula | C15H22N2O4 |
|---|---|
| Molecular weight | 294.35 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| InChIKey | LHSGPCFBGJHPCY-STQMWFEESA-N |
| SMILES | CC(C)C[C@@H](C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O)N |
Computed by PubChem (NCBI)