cas: 643-01-6 — see every product listed under this CAS number, including other names
L-Mannitol, 98%, 98% (CAS 643-01-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114RCS-100mg |
| cas | 643-01-6 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 371.60 Pln | |
| Chemat | 250mg | 611.60 Pln | |
| Chemat | 1g | 2253.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
L-mannitol is the L-enantiomer of mannitol.
Source: ChEBI
| Molecular formula | C6H14O6 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | (2S,3S,4S,5S)-hexane-1,2,3,4,5,6-hexol |
| InChIKey | FBPFZTCFMRRESA-BXKVDMCESA-N |
| SMILES | C([C@@H]([C@@H]([C@H]([C@H](CO)O)O)O)O)O |
Computed by PubChem (NCBI)