L82
cas: 329227-30-7 — see every product listed under this CAS number, including other names
L82 (CAS 329227-30-7) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 1mg, 200mg. Offered by: GLPBio, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC67785-10 |
| cas | 329227-30-7 |
| size | 10mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 962.12 Pln | |
| GLPBio | 100mg | 2941.97 Pln | |
| GLPBio | 25mg | 1425.49 Pln | |
| GLPBio | 5mg | 751.50 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 784.26 Pln | |
| GLPBio | 50mg | 2015.23 Pln | |
| Chemat | 1mg | 246.80 Pln | |
| Chemat | 5mg | 510.80 Pln | |
| Chemat | 10mg | 789.20 Pln | |
| Chemat | 25mg | 1422.80 Pln | |
| Chemat | 50mg | 2224.40 Pln | |
| Chemat | 100mg | 3477.20 Pln | |
| Chemat | 200mg | 4787.60 Pln |
properties
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
5-chloro-4-[(2E)-2-[(4-hydroxy-3-nitrophenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one (CAS 329227-30-7) is a chemical compound with the molecular formula C11H8ClN5O4 and a molecular weight of 309.66 g/mol. IUPAC name: 5-chloro-4-[(2E)-2-[(4-hydroxy-3-nitrophenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one. InChIKey: WUVOGTSGMTVCGA-YIXHJXPBSA-N.
| Molecular formula | C11H8ClN5O4 |
|---|---|
| Molecular weight | 309.66 g/mol |
| IUPAC name | 5-chloro-4-[(2E)-2-[(4-hydroxy-3-nitrophenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one |
| InChIKey | WUVOGTSGMTVCGA-YIXHJXPBSA-N |
| SMILES | C1=CC(=C(C=C1/C=N/NC2=C(C(=O)NN=C2)Cl)[N+](=O)[O-])O |
Computed by PubChem (NCBI)