cas: 945976-43-2 — see every product listed under this CAS number, including other names
LP-533401, 98%, 98% (CAS 945976-43-2) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11JNRP-5mg |
| cas | 945976-43-2 |
| size | 5mg |
| availability | 0.75g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 390.80 Pln | |
| Chemat | 10mg | 458.00 Pln | |
| Chemat | 25mg | 534.80 Pln | |
| Chemat | 50mg | 866.00 Pln | |
| Chemat | 100mg | 1427.60 Pln | |
| Chemat | 250mg | 2382.80 Pln | |
| Chemat | 1mg | 189.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-amino-3-[4-[2-amino-6-[2,2,2-trifluoro-1-[4-(3-fluorophenyl)phenyl]ethoxy]pyrimidin-4-yl]phenyl]propanoic acid (CAS 945976-43-2) is a chemical compound with the molecular formula C27H22F4N4O3 and a molecular weight of 526.5 g/mol. IUPAC name: (2S)-2-amino-3-[4-[2-amino-6-[2,2,2-trifluoro-1-[4-(3-fluorophenyl)phenyl]ethoxy]pyrimidin-4-yl]phenyl]propanoic acid. InChIKey: JZWUKILTKYJLCN-XEGCMXMBSA-N.
| Molecular formula | C27H22F4N4O3 |
|---|---|
| Molecular weight | 526.5 g/mol |
| IUPAC name | (2S)-2-amino-3-[4-[2-amino-6-[2,2,2-trifluoro-1-[4-(3-fluorophenyl)phenyl]ethoxy]pyrimidin-4-yl]phenyl]propanoic acid |
| InChIKey | JZWUKILTKYJLCN-XEGCMXMBSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=CC=C(C=C2)C(C(F)(F)F)OC3=NC(=NC(=C3)C4=CC=C(C=C4)C[C@@H](C(=O)O)N)N |
Computed by PubChem (NCBI)