cas: 2649788-46-3 — see every product listed under this CAS number, including other names
LY3537982 98% (CAS 2649788-46-3) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1553137-1mg |
| cas | 2649788-46-3 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 453.81 Pln | |
| Ambeed | 5mg | 976.69 Pln | |
| Ambeed | 10mg | 1432.81 Pln | |
| Ambeed | 25mg | 2712.19 Pln | |
| Ambeed | 50mg | 3852.50 Pln | |
| Ambeed | 100mg | 5293.19 Pln | |
| Ambeed | 250mg | 10438.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1553137 |
4-[(13aS)-10-chloro-8-fluoro-6-oxo-2-prop-2-enoyl-1,3,4,12,13,13a-hexahydropyrazino[2,1-d][1,5]benzoxazocin-9-yl]-2-amino-7-fluoro-1-benzothiophene-3-carbonitrile (CAS 2649788-46-3) is a chemical compound with the molecular formula C25H19ClF2N4O3S and a molecular weight of 529.0 g/mol. IUPAC name: 4-[(13aS)-10-chloro-8-fluoro-6-oxo-2-prop-2-enoyl-1,3,4,12,13,13a-hexahydropyrazino[2,1-d][1,5]benzoxazocin-9-yl]-2-amino-7-fluoro-1-benzothiophene-3-carbonitrile. InChIKey: OZUPICRWMLEFCS-LBPRGKRZSA-N.
| Molecular formula | C25H19ClF2N4O3S |
|---|---|
| Molecular weight | 529.0 g/mol |
| IUPAC name | 4-[(13aS)-10-chloro-8-fluoro-6-oxo-2-prop-2-enoyl-1,3,4,12,13,13a-hexahydropyrazino[2,1-d][1,5]benzoxazocin-9-yl]-2-amino-7-fluoro-1-benzothiophene-3-carbonitrile |
| InChIKey | OZUPICRWMLEFCS-LBPRGKRZSA-N |
| SMILES | C=CC(=O)N1CCN2[C@H](C1)CCOC3=C(C(=C(C=C3C2=O)F)C4=C5C(=C(SC5=C(C=C4)F)N)C#N)Cl |
Computed by PubChem (NCBI)