cas: 635318-11-5 — see every product listed under this CAS number, including other names
LY404039 98% (CAS 635318-11-5) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A358160-5mg |
| cas | 635318-11-5 |
| size | 5mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5mg | 259.12 Pln | |
| Ambeed | 10mg | 409.31 Pln | |
| Ambeed | 25mg | 837.62 Pln | |
| Ambeed | 50mg | 1416.12 Pln | |
| Ambeed | 100mg | 2222.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A358160 |
LY404039 is an organic heterobicyclic compound that is (1S,5R)-2-thiabicyclo[3.1.0]hexane carrying oxo, oxo, amino, carboxy, and carboxy groups at positions 2, 2, 4S, 4S, and 6S, respectively. It is a potent agonist of group II metabotropic glutamate receptors mGluR2 mGluR3 (Ki = 149 nM and 92 nM, respectively) and exhibits antipsychotic and anxiolytic efficacy in animal models. It has a role as an anxiolytic drug, an antipsychotic agent, a dopamine agonist and a metabotropic glutamate receptor agonist. It is an organic heterobicyclic compound, a dicarboxylic acid, a sulfone, a bridged compound and a non-proteinogenic amino acid derivative.
Source: ChEBI
| Molecular formula | C7H9NO6S |
|---|---|
| Molecular weight | 235.22 g/mol |
| IUPAC name | (1R,4S,5S,6S)-4-amino-2,2-dioxo-2lambda6-thiabicyclo[3.1.0]hexane-4,6-dicarboxylic acid |
| InChIKey | AVDUGNCTZRCAHH-MDASVERJSA-N |
| SMILES | C1[C@]([C@@H]2[C@H]([C@@H]2S1(=O)=O)C(=O)O)(C(=O)O)N |
Computed by PubChem (NCBI)