CAS 19172-47-5 appears in our catalog under these names: Lawesson’s Reagent, Lawesson's Reagent, Lawesson's Reagent, 97% , Lawesson reagent, 96.00%, Lawesson's reagent. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Chemat, Biosynth. Available pack sizes: 10g, 50g, 500g, 5g, 25g, 100g, 0,25kg, 0,5kg.
2,4-bis(4-methoxyphenyl)-2,4-bis(sulfanylidene)-1,3,2lambda5,4lambda5-dithiadiphosphetane (CAS 19172-47-5) is a chemical compound with the molecular formula C14H14O2P2S4 and a molecular weight of 404.5 g/mol. IUPAC name: 2,4-bis(4-methoxyphenyl)-2,4-bis(sulfanylidene)-1,3,2lambda5,4lambda5-dithiadiphosphetane. InChIKey: CFHGBZLNZZVTAY-UHFFFAOYSA-N.
| Molecular formula | C14H14O2P2S4 |
|---|---|
| Molecular weight | 404.5 g/mol |
| IUPAC name | 2,4-bis(4-methoxyphenyl)-2,4-bis(sulfanylidene)-1,3,2lambda5,4lambda5-dithiadiphosphetane |
| InChIKey | CFHGBZLNZZVTAY-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)P2(=S)SP(=S)(S2)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)