cas: 15187-16-3 — see every product listed under this CAS number, including other names
Lead(II) Phthalocyanine, >95.0%(T) (CAS 15187-16-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | P0766-1G |
| cas | 15187-16-3 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 272.27 Pln | |
| TCI | 25g | 1354.06 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(T) |
9,18,27,36,37,39,40,41-octaza-38lambda2-plumbadecacyclo[17.17.3.110,17.128,35.02,7.08,37.011,16.020,25.026,39.029,34]hentetraconta-1,3,5,7,9,11,13,15,17(41),18,20,22,24,26,28(40),29,31,33,35-nonadecaene (CAS 15187-16-3) is a chemical compound with the molecular formula C32H16N8Pb and a molecular weight of 720 g/mol. IUPAC name: 9,18,27,36,37,39,40,41-octaza-38lambda2-plumbadecacyclo[17.17.3.110,17.128,35.02,7.08,37.011,16.020,25.026,39.029,34]hentetraconta-1,3,5,7,9,11,13,15,17(41),18,20,22,24,26,28(40),29,31,33,35-nonadecaene. InChIKey: WSQYJDCCFQPFJC-UHFFFAOYSA-N.
| Molecular formula | C32H16N8Pb |
|---|---|
| Molecular weight | 720 g/mol |
| IUPAC name | 9,18,27,36,37,39,40,41-octaza-38lambda2-plumbadecacyclo[17.17.3.110,17.128,35.02,7.08,37.011,16.020,25.026,39.029,34]hentetraconta-1,3,5,7,9,11,13,15,17(41),18,20,22,24,26,28(40),29,31,33,35-nonadecaene |
| InChIKey | WSQYJDCCFQPFJC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=NC4=C5C=CC=CC5=C6N4[Pb]N7C(=NC2=N3)C8=CC=CC=C8C7=NC9=NC(=N6)C1=CC=CC=C19 |
Computed by PubChem (NCBI)