Linaprazan glurate
cas: 1228559-81-6 — see every product listed under this CAS number, including other names
Linaprazan glurate (CAS 1228559-81-6) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 2mg. Offered by: GLPBio, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC64858-10 |
| cas | 1228559-81-6 |
| size | 10mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 765.54 Pln | |
| GLPBio | 100mg | 2183.73 Pln | |
| GLPBio | 25mg | 1111.89 Pln | |
| GLPBio | 5mg | 634.48 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 648.53 Pln | |
| GLPBio | 50mg | 1523.78 Pln | |
| Chemat | 2mg | 155.60 Pln | |
| Chemat | 5mg | 227.60 Pln | |
| Chemat | 10mg | 338.00 Pln | |
| Chemat | 25mg | 616.40 Pln | |
| Chemat | 50mg | 947.60 Pln |
properties
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
5-[2-[[8-[(2,6-dimethylphenyl)methylamino]-2,3-dimethylimidazo[1,2-a]pyridine-6-carbonyl]amino]ethoxy]-5-oxopentanoic acid (CAS 1228559-81-6) is a chemical compound with the molecular formula C26H32N4O5 and a molecular weight of 480.6 g/mol. IUPAC name: 5-[2-[[8-[(2,6-dimethylphenyl)methylamino]-2,3-dimethylimidazo[1,2-a]pyridine-6-carbonyl]amino]ethoxy]-5-oxopentanoic acid. InChIKey: GPHPBXRKAJSSIC-UHFFFAOYSA-N.
| Molecular formula | C26H32N4O5 |
|---|---|
| Molecular weight | 480.6 g/mol |
| IUPAC name | 5-[2-[[8-[(2,6-dimethylphenyl)methylamino]-2,3-dimethylimidazo[1,2-a]pyridine-6-carbonyl]amino]ethoxy]-5-oxopentanoic acid |
| InChIKey | GPHPBXRKAJSSIC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)CNC2=CC(=CN3C2=NC(=C3C)C)C(=O)NCCOC(=O)CCCC(=O)O |
Computed by PubChem (NCBI)