Linarin, 98%
cas: 480-36-4 — see every product listed under this CAS number, including other names
Linarin, 98% (CAS 480-36-4) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 100mg, 250mg, 1g, 20mg. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11D8ZI-5mg |
| cas | 480-36-4 |
| size | 5mg |
| availability | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 131.60 Pln | |
| Chemat | 10mg | 184.40 Pln | |
| Chemat | 25mg | 294.80 Pln | |
| Chemat | 100mg | 544.40 Pln | |
| Chemat | 250mg | 789.20 Pln | |
| Chemat | 1g | 2022.80 Pln | |
| Fluorochem | 5mg | 393.63 Pln | |
| Fluorochem | 10mg | 617.51 Pln | |
| Fluorochem | 20mg | 773.70 Pln | |
| Fluorochem | 100mg | 872.63 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-hydroxy-2-(4-methoxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one (CAS 480-36-4) is a chemical compound with the molecular formula C28H32O14 and a molecular weight of 592.5 g/mol. IUPAC name: 5-hydroxy-2-(4-methoxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one. InChIKey: YFVGIJBUXMQFOF-PJOVQGMDSA-N.
| Molecular formula | C28H32O14 |
|---|---|
| Molecular weight | 592.5 g/mol |
| IUPAC name | 5-hydroxy-2-(4-methoxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one |
| InChIKey | YFVGIJBUXMQFOF-PJOVQGMDSA-N |
| SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=CC(=C4C(=C3)OC(=CC4=O)C5=CC=C(C=C5)OC)O)O)O)O)O)O)O |
Computed by PubChem (NCBI)