cas: 7459-33-8 — see every product listed under this CAS number, including other names
Linoleoylchloride, 92% GC, 92% GC (CAS 7459-33-8) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114RAH-10mg |
| cas | 7459-33-8 |
| size | 10mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 338.00 Pln | |
| Chemat | 25mg | 554.00 Pln | |
| Chemat | 50mg | 856.40 Pln | |
| Chemat | 100mg | 1322.00 Pln |
| purity | 92% GC |
|---|---|
| delivery time | 3 weeks |
(9Z,12Z)-octadeca-9,12-dienoyl chloride (CAS 7459-33-8) is a chemical compound with the molecular formula C18H31ClO and a molecular weight of 298.9 g/mol. IUPAC name: (9Z,12Z)-octadeca-9,12-dienoyl chloride. InChIKey: FBWMYSQUTZRHAT-HZJYTTRNSA-N.
| Molecular formula | C18H31ClO |
|---|---|
| Molecular weight | 298.9 g/mol |
| IUPAC name | (9Z,12Z)-octadeca-9,12-dienoyl chloride |
| InChIKey | FBWMYSQUTZRHAT-HZJYTTRNSA-N |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)Cl |
Computed by PubChem (NCBI)