cas: 935283-04-8 — see every product listed under this CAS number, including other names
Linzagolix 98% (CAS 935283-04-8) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1544041-1mg |
| cas | 935283-04-8 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 203.50 Pln | |
| Ambeed | 5mg | 364.81 Pln | |
| Ambeed | 10mg | 509.44 Pln | |
| Ambeed | 25mg | 809.81 Pln | |
| Ambeed | 50mg | 1316.00 Pln | |
| Ambeed | 100mg | 2189.31 Pln | |
| Ambeed | 250mg | 3680.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1544041 |
3-[5-[(2,3-difluoro-6-methoxyphenyl)methoxy]-2-fluoro-4-methoxyphenyl]-2,4-dioxo-1H-thieno[3,4-d]pyrimidine-5-carboxylic acid (CAS 935283-04-8) is a chemical compound with the molecular formula C22H15F3N2O7S and a molecular weight of 508.4 g/mol. IUPAC name: 3-[5-[(2,3-difluoro-6-methoxyphenyl)methoxy]-2-fluoro-4-methoxyphenyl]-2,4-dioxo-1H-thieno[3,4-d]pyrimidine-5-carboxylic acid. InChIKey: BMAAMIIYNNPHAB-UHFFFAOYSA-N.
| Molecular formula | C22H15F3N2O7S |
|---|---|
| Molecular weight | 508.4 g/mol |
| IUPAC name | 3-[5-[(2,3-difluoro-6-methoxyphenyl)methoxy]-2-fluoro-4-methoxyphenyl]-2,4-dioxo-1H-thieno[3,4-d]pyrimidine-5-carboxylic acid |
| InChIKey | BMAAMIIYNNPHAB-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)F)F)COC2=C(C=C(C(=C2)N3C(=O)C4=C(SC=C4NC3=O)C(=O)O)F)OC |
Computed by PubChem (NCBI)