CAS 1314378-10-3 appears in our catalog under these names: Lipoamido-PEG4-acid, 95%, Lipoamido–PEG4–acid, Lipoamido-PEG4-acid. Offered by: Chemat Brand, GLPBio, Biosynth, MedChemExpress, Ambeed. Available pack sizes: on request, 100mg, 250mg, 500mg, 250 mg, 100 mg, 25 mg, 50 mg.
3-[2-[2-[2-[2-[5-(dithiolan-3-yl)pentanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1314378-10-3) is a chemical compound with the molecular formula C19H35NO7S2 and a molecular weight of 453.6 g/mol. IUPAC name: 3-[2-[2-[2-[2-[5-(dithiolan-3-yl)pentanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: QJFPDZROPSGMGV-UHFFFAOYSA-N.
| Molecular formula | C19H35NO7S2 |
|---|---|
| Molecular weight | 453.6 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[5-(dithiolan-3-yl)pentanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | QJFPDZROPSGMGV-UHFFFAOYSA-N |
| SMILES | C1CSSC1CCCCC(=O)NCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)