cas: 1334172-70-1 — see every product listed under this CAS number, including other names
Lipoamido-PEG8-acid, 98%, 98% (CAS 1334172-70-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HSWH-100mg |
| cas | 1334172-70-1 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 318.80 Pln | |
| Chemat | 250mg | 496.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-[2-[2-[2-[2-[2-[2-[2-[2-[5-(dithiolan-3-yl)pentanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1334172-70-1) is a chemical compound with the molecular formula C27H51NO11S2 and a molecular weight of 629.8 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[2-[5-(dithiolan-3-yl)pentanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: ZIKXLXWMWZSKAA-UHFFFAOYSA-N.
| Molecular formula | C27H51NO11S2 |
|---|---|
| Molecular weight | 629.8 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[2-[5-(dithiolan-3-yl)pentanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | ZIKXLXWMWZSKAA-UHFFFAOYSA-N |
| SMILES | C1CSSC1CCCCC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)