Lithium difluoro(oxalato)borate, 95%
cas: 409071-16-5 — see every product listed under this CAS number, including other names
Lithium difluoro(oxalato)borate, 95% (CAS 409071-16-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 50g, 100g, 500g, 1kg, 1g. Offered by: Fluorochem, Ambeed, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F097961-5G |
| cas | 409071-16-5 |
| size | 5g |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 25g | 122.89 Pln | |
| Fluorochem | 50g | 195.78 Pln | |
| Fluorochem | 100g | 247.85 Pln | |
| Fluorochem | 500g | 810.15 Pln | |
| Fluorochem | 1kg | 1575.50 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 25g | 225.75 Pln | |
| Ambeed | 100g | 337.00 Pln | |
| Ambeed | 500g | 1021.19 Pln | |
| Ambeed | 1kg | 1688.69 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 208.84 Pln | |
| BLDpharm | 25g | 236.61 Pln | |
| BLDpharm | 100g | 353.23 Pln | |
| BLDpharm | 500g | 1097.42 Pln | |
| BLDpharm | 1kg | 1813.83 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
Lithium 2,2-difluoro-1,3-dioxa-2-boranuidacyclopentane-4,5-dione (CAS 409071-16-5) is a chemical compound with the molecular formula C2BF2LiO4 and a molecular weight of 143.8 g/mol. IUPAC name: lithium 2,2-difluoro-1,3-dioxa-2-boranuidacyclopentane-4,5-dione. InChIKey: MEDDCIKGDMDORY-UHFFFAOYSA-N.
| Molecular formula | C2BF2LiO4 |
|---|---|
| Molecular weight | 143.8 g/mol |
| IUPAC name | lithium 2,2-difluoro-1,3-dioxa-2-boranuidacyclopentane-4,5-dione |
| InChIKey | MEDDCIKGDMDORY-UHFFFAOYSA-N |
| SMILES | [Li+].[B-]1(OC(=O)C(=O)O1)(F)F |
Computed by PubChem (NCBI)
Synonyms:
Lithium difluoro(oxalato)borate, lithium;2,2-difluoro-1,3-dioxa-2-boranuidacyclopentane-4,5-dione, Lithium Difluoro(oxalato)borate (LiODFB), 2,2-Difluoro-4,5-dioxo-1,3,2-dioxaborolane Lithium Salt, Lithium 2,2-difluoro-4,5-dioxo-1,3,2-dioxaborolan-2-uide, lithium(1+) ion 2,2-difluoro-4,5-dioxo-1,3,2-dioxaborolan-2-uide, C2BF2LiO4, Lithium difluorooxalatoborate, Lithiumdifluoro(oxalato)borate, MEDDCIKGDMDORY-UHFFFAOYSA-N