cas: 139755-85-4 — see every product listed under this CAS number, including other names
Lodenafil 95% (CAS 139755-85-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A204453-1mg |
| cas | 139755-85-4 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 136.75 Pln | |
| Ambeed | 5mg | 209.06 Pln | |
| Ambeed | 10mg | 292.50 Pln | |
| Ambeed | 50mg | 704.12 Pln | |
| Ambeed | 100mg | 1021.19 Pln | |
| Ambeed | 250mg | 1749.88 Pln | |
| Ambeed | 1g | 6389.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A204453 |
5-[2-ethoxy-5-[4-(2-hydroxyethyl)piperazin-1-yl]sulfonylphenyl]-1-methyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one (CAS 139755-85-4) is a chemical compound with the molecular formula C23H32N6O5S and a molecular weight of 504.6 g/mol. IUPAC name: 5-[2-ethoxy-5-[4-(2-hydroxyethyl)piperazin-1-yl]sulfonylphenyl]-1-methyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one. InChIKey: NEYKRKVLEWKOBI-UHFFFAOYSA-N.
| Molecular formula | C23H32N6O5S |
|---|---|
| Molecular weight | 504.6 g/mol |
| IUPAC name | 5-[2-ethoxy-5-[4-(2-hydroxyethyl)piperazin-1-yl]sulfonylphenyl]-1-methyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one |
| InChIKey | NEYKRKVLEWKOBI-UHFFFAOYSA-N |
| SMILES | CCCC1=NN(C2=C1N=C(NC2=O)C3=C(C=CC(=C3)S(=O)(=O)N4CCN(CC4)CCO)OCC)C |
Computed by PubChem (NCBI)