cas: 497871-47-3 — see every product listed under this CAS number, including other names
Lurbinectedin, 99%, 99% (CAS 497871-47-3) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 25mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DJZ6-1mg |
| cas | 497871-47-3 |
| size | 1mg |
| availability | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 352.40 Pln | |
| Chemat | 5mg | 933.20 Pln | |
| Chemat | 10mg | 1538.00 Pln | |
| Chemat | 50mg | 4446.80 Pln | |
| Chemat | 25mg | 2987.60 Pln | |
| Chemat | 100mg | 6640.40 Pln | |
| Chemat | 250mg | 13878.80 Pln | |
| Chemat | 1g | 29589.20 Pln | |
| Chemat | 5g | 109346.00 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
[(1R,2R,3R,11S,12S,14R,26R)-5,12-dihydroxy-6,6'-dimethoxy-7,21,30-trimethyl-27-oxospiro[17,19,28-trioxa-24-thia-13,30-diazaheptacyclo[12.9.6.13,11.02,13.04,9.015,23.016,20]triaconta-4(9),5,7,15,20,22-hexaene-26,1'-2,3,4,9-tetrahydropyrido[3,4-b]indole]-22-yl] acetate (CAS 497871-47-3) is a chemical compound with the molecular formula C41H44N4O10S and a molecular weight of 784.9 g/mol. IUPAC name: [(1R,2R,3R,11S,12S,14R,26R)-5,12-dihydroxy-6,6'-dimethoxy-7,21,30-trimethyl-27-oxospiro[17,19,28-trioxa-24-thia-13,30-diazaheptacyclo[12.9.6.13,11.02,13.04,9.015,23.016,20]triaconta-4(9),5,7,15,20,22-hexaene-26,1'-2,3,4,9-tetrahydropyrido[3,4-b]indole]-22-yl] acetate. InChIKey: YDDMIZRDDREKEP-HWTBNCOESA-N.
| Molecular formula | C41H44N4O10S |
|---|---|
| Molecular weight | 784.9 g/mol |
| IUPAC name | [(1R,2R,3R,11S,12S,14R,26R)-5,12-dihydroxy-6,6'-dimethoxy-7,21,30-trimethyl-27-oxospiro[17,19,28-trioxa-24-thia-13,30-diazaheptacyclo[12.9.6.13,11.02,13.04,9.015,23.016,20]triaconta-4(9),5,7,15,20,22-hexaene-26,1'-2,3,4,9-tetrahydropyrido[3,4-b]indole]-22-yl] acetate |
| InChIKey | YDDMIZRDDREKEP-HWTBNCOESA-N |
| SMILES | CC1=CC2=C([C@@H]3[C@@H]4[C@H]5C6=C(C(=C7C(=C6[C@@H](N4[C@H]([C@H](C2)N3C)O)COC(=O)[C@@]8(CS5)C9=C(CCN8)C2=C(N9)C=CC(=C2)OC)OCO7)C)OC(=O)C)C(=C1OC)O |
Computed by PubChem (NCBI)