M7594_0037
cas: 774551-07-4 — see every product listed under this CAS number, including other names
M7594_0037 (CAS 774551-07-4) is a chemical reagent available from Chemat. Available pack sizes: 2mg, 200mg, 5 mg, 10 mg, 1 mg, 1mg, 5mg, 10mg. Offered by: Chemat, MedChemExpress.
| brand | Chemat |
|---|---|
| catalog number | Ch135A3O-2mg |
| cas | 774551-07-4 |
| size | 2mg |
| availability | 0.2g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 2mg | 846.80 Pln | |
| Chemat | 200mg | 6856.40 Pln | |
| MedChemExpress | 5 mg | 2479.15 Pln | |
| MedChemExpress | 10 mg | 3589.07 Pln | |
| MedChemExpress | 1 mg | 1141.68 Pln | |
| Chemat | 1mg | 582.80 Pln | |
| Chemat | 5mg | 1278.80 Pln | |
| Chemat | 10mg | 1850.00 Pln | |
| Chemat | 25mg | 2901.20 Pln | |
| Chemat | 50mg | 3966.80 Pln | |
| Chemat | 100mg | 5344.40 Pln |
properties
| delivery time | 3 weeks |
|---|
2-[2-chloro-4-[[2-(1H-indol-3-yl)ethylamino]methyl]-6-methoxyphenoxy]acetamide (CAS 774551-07-4) is a chemical compound with the molecular formula C20H22ClN3O3 and a molecular weight of 387.9 g/mol. IUPAC name: 2-[2-chloro-4-[[2-(1H-indol-3-yl)ethylamino]methyl]-6-methoxyphenoxy]acetamide. InChIKey: WGLLOUBILAXFSI-UHFFFAOYSA-N.
| Molecular formula | C20H22ClN3O3 |
|---|---|
| Molecular weight | 387.9 g/mol |
| IUPAC name | 2-[2-chloro-4-[[2-(1H-indol-3-yl)ethylamino]methyl]-6-methoxyphenoxy]acetamide |
| InChIKey | WGLLOUBILAXFSI-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)CNCCC2=CNC3=CC=CC=C32)Cl)OCC(=O)N |
Computed by PubChem (NCBI)