MAC glucuronide linker-2, 98%
cas: 229977-57-5 — see every product listed under this CAS number, including other names
MAC glucuronide linker-2, 98% (CAS 229977-57-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F554627-100MG |
| cas | 229977-57-5 |
| size | 100mg |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 216.61 Pln | |
| Fluorochem | 250mg | 336.36 Pln | |
| Fluorochem | 500mg | 456.11 Pln | |
| Fluorochem | 1g | 482.14 Pln | |
| Fluorochem | 5g | 1148.57 Pln | |
| Fluorochem | 10g | 2023.26 Pln | |
| Fluorochem | 25g | 4454.70 Pln | |
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 470.50 Pln | |
| Ambeed | 5g | 1115.75 Pln | |
| Ambeed | 10g | 1966.81 Pln | |
| Ambeed | 25g | 4364.25 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
Methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-amino-4-(hydroxymethyl)phenoxy]oxane-2-carboxylate (CAS 229977-57-5) is a chemical compound with the molecular formula C20H25NO11 and a molecular weight of 455.4 g/mol. IUPAC name: methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-amino-4-(hydroxymethyl)phenoxy]oxane-2-carboxylate. InChIKey: ZAZPQJAJSIUIEY-KVIJGQROSA-N.
| Molecular formula | C20H25NO11 |
|---|---|
| Molecular weight | 455.4 g/mol |
| IUPAC name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-amino-4-(hydroxymethyl)phenoxy]oxane-2-carboxylate |
| InChIKey | ZAZPQJAJSIUIEY-KVIJGQROSA-N |
| SMILES | CC(=O)O[C@H]1[C@@H]([C@H](O[C@H]([C@@H]1OC(=O)C)OC2=C(C=C(C=C2)CO)N)C(=O)OC)OC(=O)C |
Computed by PubChem (NCBI)
Synonyms:
MAC glucuronide linker-2, orb1909223