cas: 14024-56-7 — see every product listed under this CAS number, including other names
MAGNESIUM ACETYLACETONATE, 95%, 95% (CAS 14024-56-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 500g, 10g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112C7X-250mg |
| cas | 14024-56-7 |
| size | 250mg |
| availability | 517g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 165.20 Pln | |
| Chemat | 25g | 352.40 Pln | |
| Chemat | 100g | 1062.80 Pln | |
| Chemat | 500g | 3470.40 Pln | |
| Chemat | 10g | 222.80 Pln | |
| Chemat | 50g | 602.00 Pln | |
| Chemat | 250g | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Magnesium bis((Z)-4-oxopent-2-en-2-olate) (CAS 14024-56-7) is a chemical compound with the molecular formula C10H14MgO4 and a molecular weight of 222.52 g/mol. IUPAC name: magnesium bis((Z)-4-oxopent-2-en-2-olate). InChIKey: AKTIAGQCYPCKFX-FDGPNNRMSA-L.
| Molecular formula | C10H14MgO4 |
|---|---|
| Molecular weight | 222.52 g/mol |
| IUPAC name | magnesium bis((Z)-4-oxopent-2-en-2-olate) |
| InChIKey | AKTIAGQCYPCKFX-FDGPNNRMSA-L |
| SMILES | C/C(=C/C(=O)C)/[O-].C/C(=C/C(=O)C)/[O-].[Mg+2] |
Computed by PubChem (NCBI)